C29H15N6- — CID 59061713
[(3E,5E,7Z,9Z)-8,10-dicyano-2-[(E)-2-cyano-2-isocyano-1-phenylethenyl]-10-isocyano-9-phenyldeca-1,3,5,7,9-pentaenylidene]azanide (PubChem CID 59061713) has the molecular formula C29H15N6- and a molecular weight of 447.48 g/mol. Its IUPAC name is [(3E,5E,7Z,9Z)-8,10-dicyano-2-[(E)-2-cyano-2-isocyano-1-phenylethenyl]-10-isocyano-9-phenyldeca-1,3,5,7,9-pentaenylidene]azanide.
| Compound Name | [(3E,5E,7Z,9Z)-8,10-dicyano-2-[(E)-2-cyano-2-isocyano-1-phenylethenyl]-10-isocyano-9-phenyldeca-1,3,5,7,9-pentaenylidene]azanide |
|---|---|
| PubChem CID | 59061713 |
| Molecular Formula | C29H15N6- |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | [(3E,5E,7Z,9Z)-8,10-dicyano-2-[(E)-2-cyano-2-isocyano-1-phenylethenyl]-10-isocyano-9-phenyldeca-1,3,5,7,9-pentaenylidene]azanide |
| SMILES | [C-]#[N+]/C(C#N)=C(C(\C#N)=C\C=C\C=C\C(=C=[N-])/C(=C(\C#N)[N+]#[C-])c1ccccc1)/c1ccccc1 |
| InChI | InChI=1S/C29H15N6/c1-34-26(20-32)28(22-12-6-3-7-13-22)24(18-30)16-10-5-11-17-25(19-31)29(27(21-33)35-2)23-14-8-4-9-15-23/h3-17H/q-1/b10-5+,17-11+,24-16+,28-26-,29-27+ |
| InChIKey | NEOJGFNMTJJSOB-YFGLEESYSA-N |
| XLogP | 6.42 |
| TPSA | 102.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|