C27H18N8O4S2 — CID 59061752
N-[4-[(1Z,3Z,6E)-1,3,7-tricyano-5-(iminomethylidene)-1,7-diisocyano-6-[4-(methanesulfonamido)phenyl]hepta-1,3,6-trien-2-yl]phenyl]methanesulfonamide (PubChem CID 59061752) has the molecular formula C27H18N8O4S2 and a molecular weight of 582.63 g/mol. Its IUPAC name is N-[4-[(1Z,3Z,6E)-1,3,7-tricyano-5-(iminomethylidene)-1,7-diisocyano-6-[4-(methanesulfonamido)phenyl]hepta-1,3,6-trien-2-yl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[(1Z,3Z,6E)-1,3,7-tricyano-5-(iminomethylidene)-1,7-diisocyano-6-[4-(methanesulfonamido)phenyl]hepta-1,3,6-trien-2-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 59061752 |
| Molecular Formula | C27H18N8O4S2 |
| Molecular Weight | 582.63 g/mol |
| Exact Mass | 582.09 |
| IUPAC Name | N-[4-[(1Z,3Z,6E)-1,3,7-tricyano-5-(iminomethylidene)-1,7-diisocyano-6-[4-(methanesulfonamido)phenyl]hepta-1,3,6-trien-2-yl]phenyl]methanesulfonamide |
| SMILES | [C-]#[N+]/C(C#N)=C(C(\C#N)=C\C(=C=N)/C(=C(\C#N)[N+]#[C-])c1ccc(NS(C)(=O)=O)cc1)/c1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C27H18N8O4S2/c1-32-24(16-30)26(18-5-9-22(10-6-18)34-40(3,36)37)20(14-28)13-21(15-29)27(25(17-31)33-2)19-7-11-23(12-8-19)35-41(4,38)39/h5-13,28,34-35H,3-4H3/b21-13+,26-24+,27-25- |
| InChIKey | SPXJJNDVVXUTBE-UMYQFZITSA-N |
| XLogP | 4.06 |
| TPSA | 196.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.63 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|