C31H34N4O2S — CID 59042739
N-[4-[(2Z,4Z,6E,8E)-8-(1-butyl-3,3-dimethylindol-2-ylidene)-2,4-dicyanoocta-2,4,6-trien-3-yl]phenyl]methanesulfonamide (PubChem CID 59042739) has the molecular formula C31H34N4O2S and a molecular weight of 526.71 g/mol. Its IUPAC name is N-[4-[(2Z,4Z,6E,8E)-8-(1-butyl-3,3-dimethylindol-2-ylidene)-2,4-dicyanoocta-2,4,6-trien-3-yl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[(2Z,4Z,6E,8E)-8-(1-butyl-3,3-dimethylindol-2-ylidene)-2,4-dicyanoocta-2,4,6-trien-3-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 59042739 |
| Molecular Formula | C31H34N4O2S |
| Molecular Weight | 526.71 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | N-[4-[(2Z,4Z,6E,8E)-8-(1-butyl-3,3-dimethylindol-2-ylidene)-2,4-dicyanoocta-2,4,6-trien-3-yl]phenyl]methanesulfonamide |
| SMILES | CCCCN1/C(=C/C=C/C=C(C#N)/C(=C(/C)C#N)c2ccc(NS(C)(=O)=O)cc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C31H34N4O2S/c1-6-7-20-35-28-14-10-9-13-27(28)31(3,4)29(35)15-11-8-12-25(22-33)30(23(2)21-32)24-16-18-26(19-17-24)34-38(5,36)37/h8-19,34H,6-7,20H2,1-5H3/b11-8+,25-12+,29-15+,30-23- |
| InChIKey | CSIVYAYNZSALIK-CQGXRICASA-N |
| XLogP | 6.84 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.71 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|