C30H36IN3O4S — CID 11628898
4-[(2E)-2-[(E)-3-[5-[(2-iodoacetyl)amino]-1,3,3-trimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]butane-1-sulfonate (PubChem CID 11628898) has the molecular formula C30H36IN3O4S and a molecular weight of 661.61 g/mol. Its IUPAC name is 4-[(2E)-2-[(E)-3-[5-[(2-iodoacetyl)amino]-1,3,3-trimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]butane-1-sulfonate.
| Compound Name | 4-[(2E)-2-[(E)-3-[5-[(2-iodoacetyl)amino]-1,3,3-trimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 11628898 |
| Molecular Formula | C30H36IN3O4S |
| Molecular Weight | 661.61 g/mol |
| Exact Mass | 661.15 |
| IUPAC Name | 4-[(2E)-2-[(E)-3-[5-[(2-iodoacetyl)amino]-1,3,3-trimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]butane-1-sulfonate |
| SMILES | C[N+]1=C(/C=C/C=C2/N(CCCCS(=O)(=O)[O-])c3ccccc3C2(C)C)C(C)(C)c2cc(NC(=O)CI)ccc21 |
| InChI | InChI=1S/C30H36IN3O4S/c1-29(2)22-11-6-7-12-25(22)34(17-8-9-18-39(36,37)38)27(29)14-10-13-26-30(3,4)23-19-21(32-28(35)20-31)15-16-24(23)33(26)5/h6-7,10-16,19H,8-9,17-18,20H2,1-5H3,(H-,32,35,36,37,38) |
| InChIKey | JQNSFTNUCJFSRO-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.61 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|