C38H45N4O6S+ — CID 91401688
2-[5-[1-[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexyl]-3,3-dimethylindol-2-ylidene]penta-1,3-dienyl]-1,3,3-trimethylindol-1-ium-5-sulfonic acid (PubChem CID 91401688) has the molecular formula C38H45N4O6S+ and a molecular weight of 685.87 g/mol. Its IUPAC name is 2-[5-[1-[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexyl]-3,3-dimethylindol-2-ylidene]penta-1,3-dienyl]-1,3,3-trimethylindol-1-ium-5-sulfonic acid.
| Compound Name | 2-[5-[1-[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexyl]-3,3-dimethylindol-2-ylidene]penta-1,3-dienyl]-1,3,3-trimethylindol-1-ium-5-sulfonic acid |
|---|---|
| PubChem CID | 91401688 |
| Molecular Formula | C38H45N4O6S+ |
| Molecular Weight | 685.87 g/mol |
| Exact Mass | 685.31 |
| IUPAC Name | 2-[5-[1-[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexyl]-3,3-dimethylindol-2-ylidene]penta-1,3-dienyl]-1,3,3-trimethylindol-1-ium-5-sulfonic acid |
| SMILES | C[N+]1=C(C=CC=CC=C2N(CCCCCC(=O)NCCN3C(=O)C=CC3=O)c3ccccc3C2(C)C)C(C)(C)c2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C38H44N4O6S/c1-37(2)28-14-11-12-15-31(28)41(24-13-7-10-18-34(43)39-23-25-42-35(44)21-22-36(42)45)33(37)17-9-6-8-16-32-38(3,4)29-26-27(49(46,47)48)19-20-30(29)40(32)5/h6,8-9,11-12,14-17,19-22,26H,7,10,13,18,23-25H2,1-5H3,(H-,39,43,46,47,48)/p+1 |
| InChIKey | FAKZUFOWWUSQAZ-UHFFFAOYSA-O |
| XLogP | 5.34 |
| TPSA | 127.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.87 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|