C36H43N4O6S+ — CID 91200770
2-[3-[1-[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexyl]-3,3-dimethylindol-2-ylidene]prop-1-enyl]-1,3,3-trimethylindol-1-ium-5-sulfonic acid (PubChem CID 91200770) has the molecular formula C36H43N4O6S+ and a molecular weight of 659.83 g/mol. Its IUPAC name is 2-[3-[1-[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexyl]-3,3-dimethylindol-2-ylidene]prop-1-enyl]-1,3,3-trimethylindol-1-ium-5-sulfonic acid.
| Compound Name | 2-[3-[1-[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexyl]-3,3-dimethylindol-2-ylidene]prop-1-enyl]-1,3,3-trimethylindol-1-ium-5-sulfonic acid |
|---|---|
| PubChem CID | 91200770 |
| Molecular Formula | C36H43N4O6S+ |
| Molecular Weight | 659.83 g/mol |
| Exact Mass | 659.29 |
| IUPAC Name | 2-[3-[1-[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexyl]-3,3-dimethylindol-2-ylidene]prop-1-enyl]-1,3,3-trimethylindol-1-ium-5-sulfonic acid |
| SMILES | C[N+]1=C(C=CC=C2N(CCCCCC(=O)NCCN3C(=O)C=CC3=O)c3ccccc3C2(C)C)C(C)(C)c2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C36H42N4O6S/c1-35(2)26-12-8-9-13-29(26)39(22-10-6-7-16-32(41)37-21-23-40-33(42)19-20-34(40)43)31(35)15-11-14-30-36(3,4)27-24-25(47(44,45)46)17-18-28(27)38(30)5/h8-9,11-15,17-20,24H,6-7,10,16,21-23H2,1-5H3,(H-,37,41,44,45,46)/p+1 |
| InChIKey | PCSJLXLZGSJAOE-UHFFFAOYSA-O |
| XLogP | 4.78 |
| TPSA | 127.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.83 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|