C33H41N2O8S2- — CID 123345800
4-[5-(carboxymethyl)-2-[3-[3,3-dimethyl-1-(4-sulfonatobutyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]butane-1-sulfonate (PubChem CID 123345800) has the molecular formula C33H41N2O8S2- and a molecular weight of 657.83 g/mol. Its IUPAC name is 4-[5-(carboxymethyl)-2-[3-[3,3-dimethyl-1-(4-sulfonatobutyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]butane-1-sulfonate.
| Compound Name | 4-[5-(carboxymethyl)-2-[3-[3,3-dimethyl-1-(4-sulfonatobutyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 123345800 |
| Molecular Formula | C33H41N2O8S2- |
| Molecular Weight | 657.83 g/mol |
| Exact Mass | 657.23 |
| IUPAC Name | 4-[5-(carboxymethyl)-2-[3-[3,3-dimethyl-1-(4-sulfonatobutyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]butane-1-sulfonate |
| SMILES | CC1(C)C(=CC=CC2=[N+](CCCCS(=O)(=O)[O-])c3ccccc3C2(C)C)N(CCCCS(=O)(=O)[O-])c2ccc(CC(=O)O)cc21 |
| InChI | InChI=1S/C33H42N2O8S2/c1-32(2)25-12-5-6-13-27(25)34(18-7-9-20-44(38,39)40)29(32)14-11-15-30-33(3,4)26-22-24(23-31(36)37)16-17-28(26)35(30)19-8-10-21-45(41,42)43/h5-6,11-17,22H,7-10,18-21,23H2,1-4H3,(H2-,36,37,38,39,40,41,42,43)/p-1 |
| InChIKey | GIQXGEQRLPQAOA-UHFFFAOYSA-M |
| XLogP | 4.58 |
| TPSA | 157.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.83 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|