C30H41N3O3S+2 — CID 118731716
3-[(2Z)-3,3-dimethyl-5-sulfo-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]propyl-trimethylazanium (PubChem CID 118731716) has the molecular formula C30H41N3O3S+2 and a molecular weight of 523.74 g/mol. Its IUPAC name is 3-[(2Z)-3,3-dimethyl-5-sulfo-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]propyl-trimethylazanium.
| Compound Name | 3-[(2Z)-3,3-dimethyl-5-sulfo-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]propyl-trimethylazanium |
|---|---|
| PubChem CID | 118731716 |
| Molecular Formula | C30H41N3O3S+2 |
| Molecular Weight | 523.74 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | 3-[(2Z)-3,3-dimethyl-5-sulfo-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]propyl-trimethylazanium |
| SMILES | C[N+]1=C(/C=C/C=C2\N(CCC[N+](C)(C)C)c3ccc(S(=O)(=O)O)cc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C30H40N3O3S/c1-29(2)23-13-9-10-14-25(23)31(5)27(29)15-11-16-28-30(3,4)24-21-22(37(34,35)36)17-18-26(24)32(28)19-12-20-33(6,7)8/h9-11,13-18,21H,12,19-20H2,1-8H3/q+1/p+1 |
| InChIKey | CMRNUCALYZJJQK-UHFFFAOYSA-O |
| XLogP | 5.27 |
| TPSA | 60.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.74 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|