C11H10N4O2S — CID 67571264
N-[3-(1,2-dicyanoethenylamino)phenyl]methanesulfonamide (PubChem CID 67571264) has the molecular formula C11H10N4O2S and a molecular weight of 262.29 g/mol. Its IUPAC name is N-[3-(1,2-dicyanoethenylamino)phenyl]methanesulfonamide.
| Compound Name | N-[3-(1,2-dicyanoethenylamino)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 67571264 |
| Molecular Formula | C11H10N4O2S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | N-[3-(1,2-dicyanoethenylamino)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(NC(C#N)=CC#N)c1 |
| InChI | InChI=1S/C11H10N4O2S/c1-18(16,17)15-10-4-2-3-9(7-10)14-11(8-13)5-6-12/h2-5,7,14-15H,1H3 |
| InChIKey | MPDNBGHSPFXPFS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|