C14H13LiN2O6S2 — CID 20769669
lithium 3-[[3-(methanesulfonamido)phenyl]carbamoyl]benzenesulfonate (PubChem CID 20769669) has the molecular formula C14H13LiN2O6S2 and a molecular weight of 376.34 g/mol. Its IUPAC name is lithium 3-[[3-(methanesulfonamido)phenyl]carbamoyl]benzenesulfonate.
| Compound Name | lithium 3-[[3-(methanesulfonamido)phenyl]carbamoyl]benzenesulfonate |
|---|---|
| PubChem CID | 20769669 |
| Molecular Formula | C14H13LiN2O6S2 |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | lithium 3-[[3-(methanesulfonamido)phenyl]carbamoyl]benzenesulfonate |
| SMILES | CS(=O)(=O)Nc1cccc(NC(=O)c2cccc(S(=O)(=O)[O-])c2)c1.[Li+] |
| InChI | InChI=1S/C14H14N2O6S2.Li/c1-23(18,19)16-12-6-3-5-11(9-12)15-14(17)10-4-2-7-13(8-10)24(20,21)22;/h2-9,16H,1H3,(H,15,17)(H,20,21,22);/q;+1/p-1 |
| InChIKey | MUEBUNHGWGYRIF-UHFFFAOYSA-M |
| XLogP | -1.78 |
| TPSA | 132.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|