C29H16N6 — CID 72504206
9-(iminomethylidene)-1,11-diisocyano-2,10-diphenylundeca-1,3,5,7,10-pentaene-1,3,11-tricarbonitrile (PubChem CID 72504206) has the molecular formula C29H16N6 and a molecular weight of 448.49 g/mol. Its IUPAC name is 9-(iminomethylidene)-1,11-diisocyano-2,10-diphenylundeca-1,3,5,7,10-pentaene-1,3,11-tricarbonitrile.
| Compound Name | 9-(iminomethylidene)-1,11-diisocyano-2,10-diphenylundeca-1,3,5,7,10-pentaene-1,3,11-tricarbonitrile |
|---|---|
| PubChem CID | 72504206 |
| Molecular Formula | C29H16N6 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 9-(iminomethylidene)-1,11-diisocyano-2,10-diphenylundeca-1,3,5,7,10-pentaene-1,3,11-tricarbonitrile |
| SMILES | [C-]#[N+]C(C#N)=C(C(=C=N)C=CC=CC=C(C#N)C(=C(C#N)[N+]#[C-])c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H16N6/c1-34-26(20-32)28(22-12-6-3-7-13-22)24(18-30)16-10-5-11-17-25(19-31)29(27(21-33)35-2)23-14-8-4-9-15-23/h3-17,30H |
| InChIKey | ZVQGHWDOFODITC-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|