About (2E)-3-chloro-2-isocyano-5,5-diphenylpenta-2,4-dienenitrile
(2E)-3-chloro-2-isocyano-5,5-diphenylpenta-2,4-dienenitrile (PubChem CID 159342387) has the molecular formula C18H11ClN2
and a molecular weight of 290.75 g/mol. Its IUPAC name is (2E)-3-chloro-2-isocyano-5,5-diphenylpenta-2,4-dienenitrile.
Molecular Properties
| Compound Name | (2E)-3-chloro-2-isocyano-5,5-diphenylpenta-2,4-dienenitrile |
| PubChem CID | 159342387 |
| Molecular Formula | C18H11ClN2 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | (2E)-3-chloro-2-isocyano-5,5-diphenylpenta-2,4-dienenitrile |
| SMILES | [C-]#[N+]/C(C#N)=C(/Cl)C=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H11ClN2/c1-21-18(13-20)17(19)12-16(14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-12H/b18-17+ |
| InChIKey | LFKZYWCOFIPWAQ-ISLYRVAYSA-N |
| XLogP | 5.01 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-3-chloro-2-isocyano-5,5-diphenylpenta-2,4-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-3-chloro-2-isocyano-5,5-diphenylpenta-2,4-dienenitrile?
The IUPAC name of (2E)-3-chloro-2-isocyano-5,5-diphenylpenta-2,4-dienenitrile (CID 159342387) is (2E)-3-chloro-2-isocyano-5,5-diphenylpenta-2,4-dienenitrile.
What is the SMILES notation for (2E)-3-chloro-2-isocyano-5,5-diphenylpenta-2,4-dienenitrile?
The canonical SMILES for (2E)-3-chloro-2-isocyano-5,5-diphenylpenta-2,4-dienenitrile is [C-]#[N+]/C(C#N)=C(/Cl)C=C(c1ccccc1)c1ccccc1.
What is the InChIKey of (2E)-3-chloro-2-isocyano-5,5-diphenylpenta-2,4-dienenitrile?
The InChIKey is LFKZYWCOFIPWAQ-ISLYRVAYSA-N. The full InChI is InChI=1S/C18H11ClN2/c1-21-18(13-20)17(19)12-16(14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-12H/b18-17+.
What are the key properties of (2E)-3-chloro-2-isocyano-5,5-diphenylpenta-2,4-dienenitrile?
(2E)-3-chloro-2-isocyano-5,5-diphenylpenta-2,4-dienenitrile has a molecular weight of 290.75 g/mol, XLogP of 5.01, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-3-chloro-2-isocyano-5,5-diphenylpenta-2,4-dienenitrile is sourced from PubChem (CID 159342387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).