About (E)-3-[4-(2,2-diphenylethenyl)phenyl]-2-hydroxyprop-2-enenitrile
(E)-3-[4-(2,2-diphenylethenyl)phenyl]-2-hydroxyprop-2-enenitrile (PubChem CID 144583765) has the molecular formula C23H17NO
and a molecular weight of 323.40 g/mol. Its IUPAC name is (E)-3-[4-(2,2-diphenylethenyl)phenyl]-2-hydroxyprop-2-enenitrile.
Molecular Properties
| Compound Name | (E)-3-[4-(2,2-diphenylethenyl)phenyl]-2-hydroxyprop-2-enenitrile |
| PubChem CID | 144583765 |
| Molecular Formula | C23H17NO |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | (E)-3-[4-(2,2-diphenylethenyl)phenyl]-2-hydroxyprop-2-enenitrile |
| SMILES | N#C/C(O)=C\c1ccc(C=C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H17NO/c24-17-22(25)15-18-11-13-19(14-12-18)16-23(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-16,25H/b22-15+ |
| InChIKey | OKCZBZORLXKOQU-PXLXIMEGSA-N |
| XLogP | 5.70 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[4-(2,2-diphenylethenyl)phenyl]-2-hydroxyprop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[4-(2,2-diphenylethenyl)phenyl]-2-hydroxyprop-2-enenitrile?
The IUPAC name of (E)-3-[4-(2,2-diphenylethenyl)phenyl]-2-hydroxyprop-2-enenitrile (CID 144583765) is (E)-3-[4-(2,2-diphenylethenyl)phenyl]-2-hydroxyprop-2-enenitrile.
What is the SMILES notation for (E)-3-[4-(2,2-diphenylethenyl)phenyl]-2-hydroxyprop-2-enenitrile?
The canonical SMILES for (E)-3-[4-(2,2-diphenylethenyl)phenyl]-2-hydroxyprop-2-enenitrile is N#C/C(O)=C\c1ccc(C=C(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of (E)-3-[4-(2,2-diphenylethenyl)phenyl]-2-hydroxyprop-2-enenitrile?
The InChIKey is OKCZBZORLXKOQU-PXLXIMEGSA-N. The full InChI is InChI=1S/C23H17NO/c24-17-22(25)15-18-11-13-19(14-12-18)16-23(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-16,25H/b22-15+.
What are the key properties of (E)-3-[4-(2,2-diphenylethenyl)phenyl]-2-hydroxyprop-2-enenitrile?
(E)-3-[4-(2,2-diphenylethenyl)phenyl]-2-hydroxyprop-2-enenitrile has a molecular weight of 323.40 g/mol, XLogP of 5.70, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[4-(2,2-diphenylethenyl)phenyl]-2-hydroxyprop-2-enenitrile is sourced from PubChem (CID 144583765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).