About CID 10548364
CID 10548364 (PubChem CID 10548364) has the molecular formula C20H14N
and a molecular weight of 268.34 g/mol.
Molecular Properties
| Compound Name | CID 10548364 |
| PubChem CID | 10548364 |
| Molecular Formula | C20H14N |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | — |
| SMILES | N#Cc1ccc(/C=C(/[C]2[CH][CH][CH][CH]2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H14N/c21-15-17-12-10-16(11-13-17)14-20(19-8-4-5-9-19)18-6-2-1-3-7-18/h1-14H/b20-14+ |
| InChIKey | LCMCLECPYVQDPV-XSFVSMFZSA-N |
| XLogP | 4.50 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze CID 10548364 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10548364?
The IUPAC name of CID 10548364 (CID 10548364) is not available.
What is the SMILES notation for CID 10548364?
The canonical SMILES for CID 10548364 is N#Cc1ccc(/C=C(/[C]2[CH][CH][CH][CH]2)c2ccccc2)cc1.
What is the InChIKey of CID 10548364?
The InChIKey is LCMCLECPYVQDPV-XSFVSMFZSA-N. The full InChI is InChI=1S/C20H14N/c21-15-17-12-10-16(11-13-17)14-20(19-8-4-5-9-19)18-6-2-1-3-7-18/h1-14H/b20-14+.
What are the key properties of CID 10548364?
CID 10548364 has a molecular weight of 268.34 g/mol, XLogP of 4.50, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10548364 is sourced from PubChem (CID 10548364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).