C21H17N — CID 174934225
benzene;3,3-diphenylprop-2-enenitrile (PubChem CID 174934225) has the molecular formula C21H17N and a molecular weight of 283.37 g/mol. Its IUPAC name is benzene;3,3-diphenylprop-2-enenitrile.
| Compound Name | benzene;3,3-diphenylprop-2-enenitrile |
|---|---|
| PubChem CID | 174934225 |
| Molecular Formula | C21H17N |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | benzene;3,3-diphenylprop-2-enenitrile |
| SMILES | N#CC=C(c1ccccc1)c1ccccc1.c1ccccc1 |
| InChI | InChI=1S/C15H11N.C6H6/c16-12-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14;1-2-4-6-5-3-1/h1-11H;1-6H |
| InChIKey | FNCPBCFXWSBCGT-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|