C16H11BrF3N — CID 174367597
bromo(trifluoro)methane;3,3-diphenylprop-2-enenitrile (PubChem CID 174367597) has the molecular formula C16H11BrF3N and a molecular weight of 354.17 g/mol. Its IUPAC name is bromo(trifluoro)methane;3,3-diphenylprop-2-enenitrile.
| Compound Name | bromo(trifluoro)methane;3,3-diphenylprop-2-enenitrile |
|---|---|
| PubChem CID | 174367597 |
| Molecular Formula | C16H11BrF3N |
| Molecular Weight | 354.17 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | bromo(trifluoro)methane;3,3-diphenylprop-2-enenitrile |
| SMILES | FC(F)(F)Br.N#CC=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H11N.CBrF3/c16-12-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14;2-1(3,4)5/h1-11H; |
| InChIKey | CAFADMABFVLPTC-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.17 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|