C13H10F3NO — CID 134849106
(4Z)-5-methoxy-5-phenyl-3-(trifluoromethyl)penta-2,4-dienenitrile (PubChem CID 134849106) has the molecular formula C13H10F3NO and a molecular weight of 253.22 g/mol. Its IUPAC name is (4Z)-5-methoxy-5-phenyl-3-(trifluoromethyl)penta-2,4-dienenitrile.
| Compound Name | (4Z)-5-methoxy-5-phenyl-3-(trifluoromethyl)penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 134849106 |
| Molecular Formula | C13H10F3NO |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | (4Z)-5-methoxy-5-phenyl-3-(trifluoromethyl)penta-2,4-dienenitrile |
| SMILES | CO/C(=C\C(=CC#N)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H10F3NO/c1-18-12(10-5-3-2-4-6-10)9-11(7-8-17)13(14,15)16/h2-7,9H,1H3/b11-7?,12-9- |
| InChIKey | RKWUDBYCFLMXFC-XOADAZCVSA-N |
| XLogP | 3.69 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|