C35H34N5O3+ — CID 72621130
3-[2-(3,5-dicyano-5-isocyano-4-phenylpenta-2,4-dienylidene)-5-phenyl-1,3-benzoxazol-3-yl]propyl-bis(2-hydroxyethyl)-methylazanium (PubChem CID 72621130) has the molecular formula C35H34N5O3+ and a molecular weight of 572.69 g/mol. Its IUPAC name is 3-[2-(3,5-dicyano-5-isocyano-4-phenylpenta-2,4-dienylidene)-5-phenyl-1,3-benzoxazol-3-yl]propyl-bis(2-hydroxyethyl)-methylazanium.
| Compound Name | 3-[2-(3,5-dicyano-5-isocyano-4-phenylpenta-2,4-dienylidene)-5-phenyl-1,3-benzoxazol-3-yl]propyl-bis(2-hydroxyethyl)-methylazanium |
|---|---|
| PubChem CID | 72621130 |
| Molecular Formula | C35H34N5O3+ |
| Molecular Weight | 572.69 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | 3-[2-(3,5-dicyano-5-isocyano-4-phenylpenta-2,4-dienylidene)-5-phenyl-1,3-benzoxazol-3-yl]propyl-bis(2-hydroxyethyl)-methylazanium |
| SMILES | [C-]#[N+]C(C#N)=C(C(C#N)=CC=C1Oc2ccc(-c3ccccc3)cc2N1CCC[N+](C)(CCO)CCO)c1ccccc1 |
| InChI | InChI=1S/C35H34N5O3/c1-38-31(26-37)35(28-12-7-4-8-13-28)30(25-36)15-17-34-39(18-9-19-40(2,20-22-41)21-23-42)32-24-29(14-16-33(32)43-34)27-10-5-3-6-11-27/h3-8,10-17,24,41-42H,9,18-23H2,2H3/q+1 |
| InChIKey | PUPBZKRJUOLOPD-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.69 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|