C23H22N2O5S3 — CID 123776006
3-[2-[2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]-5-phenyl-1,3-benzoxazol-3-yl]propane-1-sulfonic acid (PubChem CID 123776006) has the molecular formula C23H22N2O5S3 and a molecular weight of 502.64 g/mol. Its IUPAC name is 3-[2-[2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]-5-phenyl-1,3-benzoxazol-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]-5-phenyl-1,3-benzoxazol-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 123776006 |
| Molecular Formula | C23H22N2O5S3 |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.07 |
| IUPAC Name | 3-[2-[2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]-5-phenyl-1,3-benzoxazol-3-yl]propane-1-sulfonic acid |
| SMILES | CCN1C(=O)C(=CC=C2Oc3ccc(-c4ccccc4)cc3N2CCCS(=O)(=O)O)SC1=S |
| InChI | InChI=1S/C23H22N2O5S3/c1-2-24-22(26)20(32-23(24)31)11-12-21-25(13-6-14-33(27,28)29)18-15-17(9-10-19(18)30-21)16-7-4-3-5-8-16/h3-5,7-12,15H,2,6,13-14H2,1H3,(H,27,28,29) |
| InChIKey | IFPJDYKPIHYTFQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|