C24H24N2OS3 — CID 21232885
(5Z)-3-butyl-5-[(2E)-2-(3-ethyl-5-phenyl-1,3-benzothiazol-2-ylidene)ethylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 21232885) has the molecular formula C24H24N2OS3 and a molecular weight of 452.67 g/mol. Its IUPAC name is (5Z)-3-butyl-5-[(2E)-2-(3-ethyl-5-phenyl-1,3-benzothiazol-2-ylidene)ethylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-butyl-5-[(2E)-2-(3-ethyl-5-phenyl-1,3-benzothiazol-2-ylidene)ethylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 21232885 |
| Molecular Formula | C24H24N2OS3 |
| Molecular Weight | 452.67 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | (5Z)-3-butyl-5-[(2E)-2-(3-ethyl-5-phenyl-1,3-benzothiazol-2-ylidene)ethylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCCN1C(=O)/C(=C/C=C2/Sc3ccc(-c4ccccc4)cc3N2CC)SC1=S |
| InChI | InChI=1S/C24H24N2OS3/c1-3-5-15-26-23(27)21(30-24(26)28)13-14-22-25(4-2)19-16-18(11-12-20(19)29-22)17-9-7-6-8-10-17/h6-14,16H,3-5,15H2,1-2H3/b21-13-,22-14+ |
| InChIKey | CATORBVDHGETFG-VOKWCDJLSA-N |
| XLogP | 6.67 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.67 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|