C29H37N3O4S4 — CID 163355528
N,N-diethylethanamine;3-[(2E)-2-[(2Z)-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]-5-phenyl-1,3-benzothiazol-3-yl]propane-1-sulfonic acid (PubChem CID 163355528) has the molecular formula C29H37N3O4S4 and a molecular weight of 619.90 g/mol. Its IUPAC name is N,N-diethylethanamine;3-[(2E)-2-[(2Z)-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]-5-phenyl-1,3-benzothiazol-3-yl]propane-1-sulfonic acid.
| Compound Name | N,N-diethylethanamine;3-[(2E)-2-[(2Z)-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]-5-phenyl-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 163355528 |
| Molecular Formula | C29H37N3O4S4 |
| Molecular Weight | 619.90 g/mol |
| Exact Mass | 619.17 |
| IUPAC Name | N,N-diethylethanamine;3-[(2E)-2-[(2Z)-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]-5-phenyl-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
| SMILES | CCN(CC)CC.CCN1C(=O)/C(=C/C=C2/Sc3ccc(-c4ccccc4)cc3N2CCCS(=O)(=O)O)SC1=S |
| InChI | InChI=1S/C23H22N2O4S4.C6H15N/c1-2-24-22(26)20(32-23(24)30)11-12-21-25(13-6-14-33(27,28)29)18-15-17(9-10-19(18)31-21)16-7-4-3-5-8-16;1-4-7(5-2)6-3/h3-5,7-12,15H,2,6,13-14H2,1H3,(H,27,28,29);4-6H2,1-3H3/b20-11-,21-12+; |
| InChIKey | NAPBGCGHVNWYGA-FBESNCCKSA-N |
| XLogP | 6.50 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.90 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|