C26H20N2OS3 — CID 3096446
5-[2-(3-ethyl-5-phenyl-1,3-benzothiazol-2-ylidene)ethylidene]-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3096446) has the molecular formula C26H20N2OS3 and a molecular weight of 472.66 g/mol. Its IUPAC name is 5-[2-(3-ethyl-5-phenyl-1,3-benzothiazol-2-ylidene)ethylidene]-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[2-(3-ethyl-5-phenyl-1,3-benzothiazol-2-ylidene)ethylidene]-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3096446 |
| Molecular Formula | C26H20N2OS3 |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | 5-[2-(3-ethyl-5-phenyl-1,3-benzothiazol-2-ylidene)ethylidene]-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=CC=C2SC(=S)N(c3ccccc3)C2=O)Sc2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C26H20N2OS3/c1-2-27-21-17-19(18-9-5-3-6-10-18)13-14-22(21)31-24(27)16-15-23-25(29)28(26(30)32-23)20-11-7-4-8-12-20/h3-17H,2H2,1H3 |
| InChIKey | JMARCHFLPMIMQK-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|