C30H28N2O2S2 — CID 21232878
(5Z)-5-[(2Z)-2-(1-ethyl-3,3-dimethyl-5-phenylindol-2-ylidene)ethylidene]-3-(4-methoxyphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 21232878) has the molecular formula C30H28N2O2S2 and a molecular weight of 512.70 g/mol. Its IUPAC name is (5Z)-5-[(2Z)-2-(1-ethyl-3,3-dimethyl-5-phenylindol-2-ylidene)ethylidene]-3-(4-methoxyphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(2Z)-2-(1-ethyl-3,3-dimethyl-5-phenylindol-2-ylidene)ethylidene]-3-(4-methoxyphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 21232878 |
| Molecular Formula | C30H28N2O2S2 |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | (5Z)-5-[(2Z)-2-(1-ethyl-3,3-dimethyl-5-phenylindol-2-ylidene)ethylidene]-3-(4-methoxyphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCN1/C(=C\C=C2/SC(=S)N(c3ccc(OC)cc3)C2=O)C(C)(C)c2cc(-c3ccccc3)ccc21 |
| InChI | InChI=1S/C30H28N2O2S2/c1-5-31-25-16-11-21(20-9-7-6-8-10-20)19-24(25)30(2,3)27(31)18-17-26-28(33)32(29(35)36-26)22-12-14-23(34-4)15-13-22/h6-19H,5H2,1-4H3/b26-17-,27-18- |
| InChIKey | VBRMRJAEMPTLEO-HXNKFHKOSA-N |
| XLogP | 7.31 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|