C24H22N2O4S3 — CID 2857654
ethyl 3-[5-methoxy-2-[2-(4-oxo-3-phenyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]-1,3-benzothiazol-3-yl]propanoate (PubChem CID 2857654) has the molecular formula C24H22N2O4S3 and a molecular weight of 498.65 g/mol. Its IUPAC name is ethyl 3-[5-methoxy-2-[2-(4-oxo-3-phenyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]-1,3-benzothiazol-3-yl]propanoate.
| Compound Name | ethyl 3-[5-methoxy-2-[2-(4-oxo-3-phenyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]-1,3-benzothiazol-3-yl]propanoate |
|---|---|
| PubChem CID | 2857654 |
| Molecular Formula | C24H22N2O4S3 |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | ethyl 3-[5-methoxy-2-[2-(4-oxo-3-phenyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]-1,3-benzothiazol-3-yl]propanoate |
| SMILES | CCOC(=O)CCN1C(=CC=C2SC(=S)N(c3ccccc3)C2=O)Sc2ccc(OC)cc21 |
| InChI | InChI=1S/C24H22N2O4S3/c1-3-30-22(27)13-14-25-18-15-17(29-2)9-10-19(18)32-21(25)12-11-20-23(28)26(24(31)33-20)16-7-5-4-6-8-16/h4-12,15H,3,13-14H2,1-2H3 |
| InChIKey | BYSNXQGDHUYFDA-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|