C22H20N2OS3 — CID 3115038
3-butyl-5-[2-(3-phenyl-1,3-benzothiazol-2-ylidene)ethylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3115038) has the molecular formula C22H20N2OS3 and a molecular weight of 424.62 g/mol. Its IUPAC name is 3-butyl-5-[2-(3-phenyl-1,3-benzothiazol-2-ylidene)ethylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-butyl-5-[2-(3-phenyl-1,3-benzothiazol-2-ylidene)ethylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3115038 |
| Molecular Formula | C22H20N2OS3 |
| Molecular Weight | 424.62 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 3-butyl-5-[2-(3-phenyl-1,3-benzothiazol-2-ylidene)ethylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCCN1C(=O)C(=CC=C2Sc3ccccc3N2c2ccccc2)SC1=S |
| InChI | InChI=1S/C22H20N2OS3/c1-2-3-15-23-21(25)19(28-22(23)26)13-14-20-24(16-9-5-4-6-10-16)17-11-7-8-12-18(17)27-20/h4-14H,2-3,15H2,1H3 |
| InChIKey | DDCPBMKKBSCABF-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.62 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|