C21H24N2OS3 — CID 76662170
5-[2-(3-hexyl-1,3-benzothiazol-2-ylidene)ethylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 76662170) has the molecular formula C21H24N2OS3 and a molecular weight of 416.64 g/mol. Its IUPAC name is 5-[2-(3-hexyl-1,3-benzothiazol-2-ylidene)ethylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[2-(3-hexyl-1,3-benzothiazol-2-ylidene)ethylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 76662170 |
| Molecular Formula | C21H24N2OS3 |
| Molecular Weight | 416.64 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 5-[2-(3-hexyl-1,3-benzothiazol-2-ylidene)ethylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)C(=CC=C2Sc3ccccc3N2CCCCCC)SC1=S |
| InChI | InChI=1S/C21H24N2OS3/c1-3-5-6-9-15-22-16-10-7-8-11-17(16)26-19(22)13-12-18-20(24)23(14-4-2)21(25)27-18/h4,7-8,10-13H,2-3,5-6,9,14-15H2,1H3 |
| InChIKey | ZFWGYYGSFZZLEI-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.64 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|