C25H22N2O3S3 — CID 165367325
(4-ethenylphenyl)methyl 2-[5-[2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate (PubChem CID 165367325) has the molecular formula C25H22N2O3S3 and a molecular weight of 494.66 g/mol. Its IUPAC name is (4-ethenylphenyl)methyl 2-[5-[2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate.
| Compound Name | (4-ethenylphenyl)methyl 2-[5-[2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 165367325 |
| Molecular Formula | C25H22N2O3S3 |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | (4-ethenylphenyl)methyl 2-[5-[2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
| SMILES | C=Cc1ccc(COC(=O)CN2C(=O)C(=CC=C3Sc4ccccc4N3CC)SC2=S)cc1 |
| InChI | InChI=1S/C25H22N2O3S3/c1-3-17-9-11-18(12-10-17)16-30-23(28)15-27-24(29)21(33-25(27)31)13-14-22-26(4-2)19-7-5-6-8-20(19)32-22/h3,5-14H,1,4,15-16H2,2H3 |
| InChIKey | OKXIEAUEAMQCKM-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|