C19H18N2O3S3 — CID 71436868
3-[3-ethyl-2-[2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]-1,3-benzothiazol-6-yl]prop-2-enoic acid (PubChem CID 71436868) has the molecular formula C19H18N2O3S3 and a molecular weight of 418.57 g/mol. Its IUPAC name is 3-[3-ethyl-2-[2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]-1,3-benzothiazol-6-yl]prop-2-enoic acid.
| Compound Name | 3-[3-ethyl-2-[2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]-1,3-benzothiazol-6-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 71436868 |
| Molecular Formula | C19H18N2O3S3 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 3-[3-ethyl-2-[2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]-1,3-benzothiazol-6-yl]prop-2-enoic acid |
| SMILES | CCN1C(=O)C(=CC=C2Sc3cc(C=CC(=O)O)ccc3N2CC)SC1=S |
| InChI | InChI=1S/C19H18N2O3S3/c1-3-20-13-7-5-12(6-10-17(22)23)11-15(13)26-16(20)9-8-14-18(24)21(4-2)19(25)27-14/h5-11H,3-4H2,1-2H3,(H,22,23) |
| InChIKey | SLEFWRIXKUHVST-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|