C20H18N2O7S3 — CID 59600858
2-[(5E)-5-[(2Z)-2-(6-acetyloxy-3-ethyl-5-methoxycarbonyl-1,3-benzothiazol-2-ylidene)ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 59600858) has the molecular formula C20H18N2O7S3 and a molecular weight of 494.57 g/mol. Its IUPAC name is 2-[(5E)-5-[(2Z)-2-(6-acetyloxy-3-ethyl-5-methoxycarbonyl-1,3-benzothiazol-2-ylidene)ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5E)-5-[(2Z)-2-(6-acetyloxy-3-ethyl-5-methoxycarbonyl-1,3-benzothiazol-2-ylidene)ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 59600858 |
| Molecular Formula | C20H18N2O7S3 |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | 2-[(5E)-5-[(2Z)-2-(6-acetyloxy-3-ethyl-5-methoxycarbonyl-1,3-benzothiazol-2-ylidene)ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CCN1/C(=C/C=C2/SC(=S)N(CC(=O)O)C2=O)Sc2cc(OC(C)=O)c(C(=O)OC)cc21 |
| InChI | InChI=1S/C20H18N2O7S3/c1-4-21-12-7-11(19(27)28-3)13(29-10(2)23)8-15(12)31-16(21)6-5-14-18(26)22(9-17(24)25)20(30)32-14/h5-8H,4,9H2,1-3H3,(H,24,25)/b14-5+,16-6- |
| InChIKey | DHOHUQSJWKFDLY-ISJKIFLQSA-N |
| XLogP | 3.00 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|