C18H18N2O6S2 — CID 88996705
2-[(5E)-5-[(2Z)-2-[3-ethyl-5-(methylperoxymethyl)-1,3-benzoxazol-2-ylidene]ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 88996705) has the molecular formula C18H18N2O6S2 and a molecular weight of 422.48 g/mol. Its IUPAC name is 2-[(5E)-5-[(2Z)-2-[3-ethyl-5-(methylperoxymethyl)-1,3-benzoxazol-2-ylidene]ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5E)-5-[(2Z)-2-[3-ethyl-5-(methylperoxymethyl)-1,3-benzoxazol-2-ylidene]ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 88996705 |
| Molecular Formula | C18H18N2O6S2 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 2-[(5E)-5-[(2Z)-2-[3-ethyl-5-(methylperoxymethyl)-1,3-benzoxazol-2-ylidene]ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CCN1/C(=C/C=C2/SC(=S)N(CC(=O)O)C2=O)Oc2ccc(COOC)cc21 |
| InChI | InChI=1S/C18H18N2O6S2/c1-3-19-12-8-11(10-25-24-2)4-5-13(12)26-15(19)7-6-14-17(23)20(9-16(21)22)18(27)28-14/h4-8H,3,9-10H2,1-2H3,(H,21,22)/b14-6+,15-7- |
| InChIKey | PPGRGYUTRQXCRK-QSPLRUFESA-N |
| XLogP | 2.65 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|