C16H12Br2N2O3S3 — CID 59600938
2-[(5E)-5-[(2Z)-2-(5,6-dibromo-3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 59600938) has the molecular formula C16H12Br2N2O3S3 and a molecular weight of 536.29 g/mol. Its IUPAC name is 2-[(5E)-5-[(2Z)-2-(5,6-dibromo-3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5E)-5-[(2Z)-2-(5,6-dibromo-3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 59600938 |
| Molecular Formula | C16H12Br2N2O3S3 |
| Molecular Weight | 536.29 g/mol |
| Exact Mass | 533.84 |
| IUPAC Name | 2-[(5E)-5-[(2Z)-2-(5,6-dibromo-3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CCN1/C(=C/C=C2/SC(=S)N(CC(=O)O)C2=O)Sc2cc(Br)c(Br)cc21 |
| InChI | InChI=1S/C16H12Br2N2O3S3/c1-2-19-10-5-8(17)9(18)6-12(10)25-13(19)4-3-11-15(23)20(7-14(21)22)16(24)26-11/h3-6H,2,7H2,1H3,(H,21,22)/b11-3+,13-4- |
| InChIKey | PAXUVYAQWFNGRL-RDGJPAMLSA-N |
| XLogP | 4.81 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.29 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|