C19H18Cl2N2O3S3 — CID 59600940
2-[(5E)-5-[(1Z)-1-(5,6-dichloro-3-ethyl-1,3-benzothiazol-2-ylidene)-3-methylbutan-2-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 59600940) has the molecular formula C19H18Cl2N2O3S3 and a molecular weight of 489.47 g/mol. Its IUPAC name is 2-[(5E)-5-[(1Z)-1-(5,6-dichloro-3-ethyl-1,3-benzothiazol-2-ylidene)-3-methylbutan-2-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5E)-5-[(1Z)-1-(5,6-dichloro-3-ethyl-1,3-benzothiazol-2-ylidene)-3-methylbutan-2-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 59600940 |
| Molecular Formula | C19H18Cl2N2O3S3 |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 487.99 |
| IUPAC Name | 2-[(5E)-5-[(1Z)-1-(5,6-dichloro-3-ethyl-1,3-benzothiazol-2-ylidene)-3-methylbutan-2-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CCN1/C(=C/C(=C2/SC(=S)N(CC(=O)O)C2=O)C(C)C)Sc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C19H18Cl2N2O3S3/c1-4-22-13-6-11(20)12(21)7-14(13)28-15(22)5-10(9(2)3)17-18(26)23(8-16(24)25)19(27)29-17/h5-7,9H,4,8H2,1-3H3,(H,24,25)/b15-5-,17-10- |
| InChIKey | BZBHBPFEDZDXCT-ISCCKJRDSA-N |
| XLogP | 5.62 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|