C18H17Cl2N2O6PS3 — CID 59600910
(4E,5Z)-5-(5,6-dichloro-3-ethyl-1,3-benzothiazol-2-ylidene)-4-[4-oxo-3-(phosphonomethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]pentanoic acid (PubChem CID 59600910) has the molecular formula C18H17Cl2N2O6PS3 and a molecular weight of 555.42 g/mol. Its IUPAC name is (4E,5Z)-5-(5,6-dichloro-3-ethyl-1,3-benzothiazol-2-ylidene)-4-[4-oxo-3-(phosphonomethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]pentanoic acid.
| Compound Name | (4E,5Z)-5-(5,6-dichloro-3-ethyl-1,3-benzothiazol-2-ylidene)-4-[4-oxo-3-(phosphonomethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]pentanoic acid |
|---|---|
| PubChem CID | 59600910 |
| Molecular Formula | C18H17Cl2N2O6PS3 |
| Molecular Weight | 555.42 g/mol |
| Exact Mass | 553.94 |
| IUPAC Name | (4E,5Z)-5-(5,6-dichloro-3-ethyl-1,3-benzothiazol-2-ylidene)-4-[4-oxo-3-(phosphonomethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]pentanoic acid |
| SMILES | CCN1/C(=C/C(CCC(=O)O)=C2/SC(=S)N(CP(=O)(O)O)C2=O)Sc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C18H17Cl2N2O6PS3/c1-2-21-12-6-10(19)11(20)7-13(12)31-14(21)5-9(3-4-15(23)24)16-17(25)22(18(30)32-16)8-29(26,27)28/h5-7H,2-4,8H2,1H3,(H,23,24)(H2,26,27,28)/b14-5-,16-9+ |
| InChIKey | KGKJOSNVNJFKQF-ZXDNEXFESA-N |
| XLogP | 4.88 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|