C13H16N2O3S3 — CID 57047406
2-[5-[1-(3-methyl-1,3-thiazolidin-2-ylidene)butan-2-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 57047406) has the molecular formula C13H16N2O3S3 and a molecular weight of 344.48 g/mol. Its IUPAC name is 2-[5-[1-(3-methyl-1,3-thiazolidin-2-ylidene)butan-2-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[5-[1-(3-methyl-1,3-thiazolidin-2-ylidene)butan-2-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 57047406 |
| Molecular Formula | C13H16N2O3S3 |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 2-[5-[1-(3-methyl-1,3-thiazolidin-2-ylidene)butan-2-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CCC(C=C1SCCN1C)=C1SC(=S)N(CC(=O)O)C1=O |
| InChI | InChI=1S/C13H16N2O3S3/c1-3-8(6-9-14(2)4-5-20-9)11-12(18)15(7-10(16)17)13(19)21-11/h6H,3-5,7H2,1-2H3,(H,16,17) |
| InChIKey | HLYYHDWOIUACHB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|