C20H20N2O3S3 — CID 173459673
2-[2-(3-ethyl-1,3-thiazolidin-2-ylidene)-1-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethyl]benzoic acid (PubChem CID 173459673) has the molecular formula C20H20N2O3S3 and a molecular weight of 432.59 g/mol. Its IUPAC name is 2-[2-(3-ethyl-1,3-thiazolidin-2-ylidene)-1-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethyl]benzoic acid.
| Compound Name | 2-[2-(3-ethyl-1,3-thiazolidin-2-ylidene)-1-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethyl]benzoic acid |
|---|---|
| PubChem CID | 173459673 |
| Molecular Formula | C20H20N2O3S3 |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 2-[2-(3-ethyl-1,3-thiazolidin-2-ylidene)-1-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethyl]benzoic acid |
| SMILES | C=CCN1C(=O)C(=C(C=C2SCCN2CC)c2ccccc2C(=O)O)SC1=S |
| InChI | InChI=1S/C20H20N2O3S3/c1-3-9-22-18(23)17(28-20(22)26)15(12-16-21(4-2)10-11-27-16)13-7-5-6-8-14(13)19(24)25/h3,5-8,12H,1,4,9-11H2,2H3,(H,24,25) |
| InChIKey | AEVFZDPGHFUBJN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|