C14H17N2O6S4- — CID 59939024
4-[(2Z)-2-[(2Z)-2-[3-(carboxymethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]ethylidene]-1,3-thiazolidin-3-yl]butane-1-sulfonate (PubChem CID 59939024) has the molecular formula C14H17N2O6S4- and a molecular weight of 437.57 g/mol. Its IUPAC name is 4-[(2Z)-2-[(2Z)-2-[3-(carboxymethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]ethylidene]-1,3-thiazolidin-3-yl]butane-1-sulfonate.
| Compound Name | 4-[(2Z)-2-[(2Z)-2-[3-(carboxymethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]ethylidene]-1,3-thiazolidin-3-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 59939024 |
| Molecular Formula | C14H17N2O6S4- |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.00 |
| IUPAC Name | 4-[(2Z)-2-[(2Z)-2-[3-(carboxymethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]ethylidene]-1,3-thiazolidin-3-yl]butane-1-sulfonate |
| SMILES | O=C(O)CN1C(=O)/C(=C/C=C2\SCCN2CCCCS(=O)(=O)[O-])SC1=S |
| InChI | InChI=1S/C14H18N2O6S4/c17-12(18)9-16-13(19)10(25-14(16)23)3-4-11-15(6-7-24-11)5-1-2-8-26(20,21)22/h3-4H,1-2,5-9H2,(H,17,18)(H,20,21,22)/p-1/b10-3-,11-4- |
| InChIKey | DNBCYQKWSPTXEK-NPHMRBADSA-M |
| XLogP | 1.03 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|