C14H19N3O2S3 — CID 123746398
3-[2-[2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]-1,3-thiazolidin-3-yl]-N-methylpropanamide (PubChem CID 123746398) has the molecular formula C14H19N3O2S3 and a molecular weight of 357.53 g/mol. Its IUPAC name is 3-[2-[2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]-1,3-thiazolidin-3-yl]-N-methylpropanamide.
| Compound Name | 3-[2-[2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]-1,3-thiazolidin-3-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 123746398 |
| Molecular Formula | C14H19N3O2S3 |
| Molecular Weight | 357.53 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 3-[2-[2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]-1,3-thiazolidin-3-yl]-N-methylpropanamide |
| SMILES | CCN1C(=O)C(=CC=C2SCCN2CCC(=O)NC)SC1=S |
| InChI | InChI=1S/C14H19N3O2S3/c1-3-17-13(19)10(22-14(17)20)4-5-12-16(8-9-21-12)7-6-11(18)15-2/h4-5H,3,6-9H2,1-2H3,(H,15,18) |
| InChIKey | UWAVFTVDEXCBNP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.53 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|