C15H15KN2O3S3 — CID 23702783
potassium (2E)-2-[(E,4Z)-4-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)but-2-enylidene]-3,4-dimethyl-1,3-thiazole-5-carboxylate (PubChem CID 23702783) has the molecular formula C15H15KN2O3S3 and a molecular weight of 406.60 g/mol. Its IUPAC name is potassium (2E)-2-[(E,4Z)-4-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)but-2-enylidene]-3,4-dimethyl-1,3-thiazole-5-carboxylate.
| Compound Name | potassium (2E)-2-[(E,4Z)-4-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)but-2-enylidene]-3,4-dimethyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 23702783 |
| Molecular Formula | C15H15KN2O3S3 |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 405.99 |
| IUPAC Name | potassium (2E)-2-[(E,4Z)-4-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)but-2-enylidene]-3,4-dimethyl-1,3-thiazole-5-carboxylate |
| SMILES | CCN1C(=O)/C(=C/C=C/C=C2/SC(C(=O)[O-])=C(C)N2C)SC1=S.[K+] |
| InChI | InChI=1S/C15H16N2O3S3.K/c1-4-17-13(18)10(22-15(17)21)7-5-6-8-11-16(3)9(2)12(23-11)14(19)20;/h5-8H,4H2,1-3H3,(H,19,20);/q;+1/p-1/b6-5+,10-7-,11-8+; |
| InChIKey | NZIGLKHUBMVIRV-YWXWJVGTSA-M |
| XLogP | -1.19 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|