C9H15NOS2 — CID 143798056
ethane;(5E)-3-ethyl-5-ethylidene-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 143798056) has the molecular formula C9H15NOS2 and a molecular weight of 217.36 g/mol. Its IUPAC name is ethane;(5E)-3-ethyl-5-ethylidene-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | ethane;(5E)-3-ethyl-5-ethylidene-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 143798056 |
| Molecular Formula | C9H15NOS2 |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | ethane;(5E)-3-ethyl-5-ethylidene-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | C/C=C1/SC(=S)N(CC)C1=O.CC |
| InChI | InChI=1S/C7H9NOS2.C2H6/c1-3-5-6(9)8(4-2)7(10)11-5;1-2/h3H,4H2,1-2H3;1-2H3/b5-3+; |
| InChIKey | VNIOPQGPSQGHTN-WGCWOXMQSA-N |
| XLogP | 2.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|