C7H7NO3S2W2 — CID 59475930
2-[(5Z)-5-ethylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid;tungsten (PubChem CID 59475930) has the molecular formula C7H7NO3S2W2 and a molecular weight of 584.95 g/mol. Its IUPAC name is 2-[(5Z)-5-ethylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid;tungsten.
| Compound Name | 2-[(5Z)-5-ethylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid;tungsten |
|---|---|
| PubChem CID | 59475930 |
| Molecular Formula | C7H7NO3S2W2 |
| Molecular Weight | 584.95 g/mol |
| Exact Mass | 584.89 |
| IUPAC Name | 2-[(5Z)-5-ethylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid;tungsten |
| SMILES | C/C=C1\SC(=S)N(CC(=O)O)C1=O.[W].[W] |
| InChI | InChI=1S/C7H7NO3S2.2W/c1-2-4-6(11)8(3-5(9)10)7(12)13-4;;/h2H,3H2,1H3,(H,9,10);;/b4-2-;; |
| InChIKey | MHIKRDYFDRUYQJ-IUDDPPFWSA-N |
| XLogP | 0.83 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.95 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|