C8H9NOS3 — CID 126709744
1-[(5Z)-5-ethylidene-2,4-bis(sulfanylidene)-1,3-thiazolidin-3-yl]propan-2-one (PubChem CID 126709744) has the molecular formula C8H9NOS3 and a molecular weight of 231.37 g/mol. Its IUPAC name is 1-[(5Z)-5-ethylidene-2,4-bis(sulfanylidene)-1,3-thiazolidin-3-yl]propan-2-one.
| Compound Name | 1-[(5Z)-5-ethylidene-2,4-bis(sulfanylidene)-1,3-thiazolidin-3-yl]propan-2-one |
|---|---|
| PubChem CID | 126709744 |
| Molecular Formula | C8H9NOS3 |
| Molecular Weight | 231.37 g/mol |
| Exact Mass | 230.98 |
| IUPAC Name | 1-[(5Z)-5-ethylidene-2,4-bis(sulfanylidene)-1,3-thiazolidin-3-yl]propan-2-one |
| SMILES | C/C=C1\SC(=S)N(CC(C)=O)C1=S |
| InChI | InChI=1S/C8H9NOS3/c1-3-6-7(11)9(4-5(2)10)8(12)13-6/h3H,4H2,1-2H3/b6-3- |
| InChIKey | UPQSHJLBPWLTBD-UTCJRWHESA-N |
| XLogP | 2.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|