C19H22N2O3S2 — CID 175753648
6-(5-ethylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)hexanoic acid;1H-indole (PubChem CID 175753648) has the molecular formula C19H22N2O3S2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 6-(5-ethylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)hexanoic acid;1H-indole.
| Compound Name | 6-(5-ethylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)hexanoic acid;1H-indole |
|---|---|
| PubChem CID | 175753648 |
| Molecular Formula | C19H22N2O3S2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 6-(5-ethylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)hexanoic acid;1H-indole |
| SMILES | CC=C1SC(=S)N(CCCCCC(=O)O)C1=O.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C11H15NO3S2.C8H7N/c1-2-8-10(15)12(11(16)17-8)7-5-3-4-6-9(13)14;1-2-4-8-7(3-1)5-6-9-8/h2H,3-7H2,1H3,(H,13,14);1-6,9H |
| InChIKey | JVQJOIURFVKOSE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|