C13H18N2O4S4 — CID 138395236
3-[(2Z)-2-[(2Z)-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]-1,3-thiazolidin-3-yl]propane-1-sulfonic acid (PubChem CID 138395236) has the molecular formula C13H18N2O4S4 and a molecular weight of 394.57 g/mol. Its IUPAC name is 3-[(2Z)-2-[(2Z)-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]-1,3-thiazolidin-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[(2Z)-2-[(2Z)-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]-1,3-thiazolidin-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 138395236 |
| Molecular Formula | C13H18N2O4S4 |
| Molecular Weight | 394.57 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | 3-[(2Z)-2-[(2Z)-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]-1,3-thiazolidin-3-yl]propane-1-sulfonic acid |
| SMILES | CCN1C(=O)/C(=C/C=C2\SCCN2CCCS(=O)(=O)O)SC1=S |
| InChI | InChI=1S/C13H18N2O4S4/c1-2-15-12(16)10(22-13(15)20)4-5-11-14(7-8-21-11)6-3-9-23(17,18)19/h4-5H,2-3,6-9H2,1H3,(H,17,18,19)/b10-4-,11-5- |
| InChIKey | AXWHPZQBTSTJKV-GGXLTUIBSA-N |
| XLogP | 1.92 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.57 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|