C14H20N2O5S3 — CID 20837952
3-[(2Z)-2-[(2Z)-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]pyrrolidin-1-yl]propyl hydrogen sulfate (PubChem CID 20837952) has the molecular formula C14H20N2O5S3 and a molecular weight of 392.52 g/mol. Its IUPAC name is 3-[(2Z)-2-[(2Z)-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]pyrrolidin-1-yl]propyl hydrogen sulfate.
| Compound Name | 3-[(2Z)-2-[(2Z)-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]pyrrolidin-1-yl]propyl hydrogen sulfate |
|---|---|
| PubChem CID | 20837952 |
| Molecular Formula | C14H20N2O5S3 |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | 3-[(2Z)-2-[(2Z)-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]pyrrolidin-1-yl]propyl hydrogen sulfate |
| SMILES | CCN1C(=O)/C(=C/C=C2/CCCN2CCCOS(=O)(=O)O)SC1=S |
| InChI | InChI=1S/C14H20N2O5S3/c1-2-16-13(17)12(23-14(16)22)7-6-11-5-3-8-15(11)9-4-10-21-24(18,19)20/h6-7H,2-5,8-10H2,1H3,(H,18,19,20)/b11-6-,12-7- |
| InChIKey | VUVLDJJPEKFUOO-IODUZNRKSA-N |
| XLogP | 1.94 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|