C22H29Cl2N3OS2Si — CID 57262720
5-[2-[5,6-dichloro-1-ethyl-3-(3-trimethylsilylpropyl)benzimidazol-2-ylidene]ethylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 57262720) has the molecular formula C22H29Cl2N3OS2Si and a molecular weight of 514.62 g/mol. Its IUPAC name is 5-[2-[5,6-dichloro-1-ethyl-3-(3-trimethylsilylpropyl)benzimidazol-2-ylidene]ethylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[2-[5,6-dichloro-1-ethyl-3-(3-trimethylsilylpropyl)benzimidazol-2-ylidene]ethylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 57262720 |
| Molecular Formula | C22H29Cl2N3OS2Si |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 513.09 |
| IUPAC Name | 5-[2-[5,6-dichloro-1-ethyl-3-(3-trimethylsilylpropyl)benzimidazol-2-ylidene]ethylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)C(=CC=C2N(CC)c3cc(Cl)c(Cl)cc3N2CCC[Si](C)(C)C)SC1=S |
| InChI | InChI=1S/C22H29Cl2N3OS2Si/c1-6-25-17-13-15(23)16(24)14-18(17)27(11-8-12-31(3,4)5)20(25)10-9-19-21(28)26(7-2)22(29)30-19/h9-10,13-14H,6-8,11-12H2,1-5H3 |
| InChIKey | LHBLTTKWHRNAHV-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|