C19H22N2O5S3Se — CID 19839117
3-[(2E)-2-[(2Z)-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]-6-methoxy-5-methyl-1,3-benzoselenazol-3-yl]propane-1-sulfonic acid (PubChem CID 19839117) has the molecular formula C19H22N2O5S3Se and a molecular weight of 533.56 g/mol. Its IUPAC name is 3-[(2E)-2-[(2Z)-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]-6-methoxy-5-methyl-1,3-benzoselenazol-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[(2E)-2-[(2Z)-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]-6-methoxy-5-methyl-1,3-benzoselenazol-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 19839117 |
| Molecular Formula | C19H22N2O5S3Se |
| Molecular Weight | 533.56 g/mol |
| Exact Mass | 533.99 |
| IUPAC Name | 3-[(2E)-2-[(2Z)-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)ethylidene]-6-methoxy-5-methyl-1,3-benzoselenazol-3-yl]propane-1-sulfonic acid |
| SMILES | CCN1C(=O)/C(=C/C=C2/[Se]c3cc(OC)c(C)cc3N2CCCS(=O)(=O)O)SC1=S |
| InChI | InChI=1S/C19H22N2O5S3Se/c1-4-20-18(22)15(28-19(20)27)6-7-17-21(8-5-9-29(23,24)25)13-10-12(2)14(26-3)11-16(13)30-17/h6-7,10-11H,4-5,8-9H2,1-3H3,(H,23,24,25)/b15-6-,17-7+ |
| InChIKey | NMQMSPCDTACXBE-NJDLGULUSA-N |
| XLogP | 2.04 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.56 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|