C14H18N2O6S4 — CID 58650766
2-[(5Z)-4-oxo-2-sulfanylidene-5-[(2Z)-2-[3-[4-(trioxidanylsulfanyl)butyl]-1,3-thiazolidin-2-ylidene]ethylidene]-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 58650766) has the molecular formula C14H18N2O6S4 and a molecular weight of 438.57 g/mol. Its IUPAC name is 2-[(5Z)-4-oxo-2-sulfanylidene-5-[(2Z)-2-[3-[4-(trioxidanylsulfanyl)butyl]-1,3-thiazolidin-2-ylidene]ethylidene]-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-4-oxo-2-sulfanylidene-5-[(2Z)-2-[3-[4-(trioxidanylsulfanyl)butyl]-1,3-thiazolidin-2-ylidene]ethylidene]-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 58650766 |
| Molecular Formula | C14H18N2O6S4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.00 |
| IUPAC Name | 2-[(5Z)-4-oxo-2-sulfanylidene-5-[(2Z)-2-[3-[4-(trioxidanylsulfanyl)butyl]-1,3-thiazolidin-2-ylidene]ethylidene]-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)/C(=C/C=C2\SCCN2CCCCSOOO)SC1=S |
| InChI | InChI=1S/C14H18N2O6S4/c17-12(18)9-16-13(19)10(26-14(16)23)3-4-11-15(6-8-24-11)5-1-2-7-25-22-21-20/h3-4,20H,1-2,5-9H2,(H,17,18)/b10-3-,11-4- |
| InChIKey | NSGMHACWBDRRGQ-NPHMRBADSA-N |
| XLogP | 2.56 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|