C19H14N2O3S3 — CID 71769156
2-[(5Z)-5-[(10-methylphenothiazin-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 71769156) has the molecular formula C19H14N2O3S3 and a molecular weight of 414.53 g/mol. Its IUPAC name is 2-[(5Z)-5-[(10-methylphenothiazin-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-5-[(10-methylphenothiazin-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 71769156 |
| Molecular Formula | C19H14N2O3S3 |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | 2-[(5Z)-5-[(10-methylphenothiazin-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CN1c2ccccc2Sc2cc(/C=C3\SC(=S)N(CC(=O)O)C3=O)ccc21 |
| InChI | InChI=1S/C19H14N2O3S3/c1-20-12-4-2-3-5-14(12)26-15-8-11(6-7-13(15)20)9-16-18(24)21(10-17(22)23)19(25)27-16/h2-9H,10H2,1H3,(H,22,23)/b16-9- |
| InChIKey | AQYOUKYLRXVKPP-SXGWCWSVSA-N |
| XLogP | 4.20 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|