C27H22N2O2S3 — CID 5221372
5-[(4-methylphenyl)methylidene]-3-(4-oxo-4-phenothiazin-10-ylbutyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 5221372) has the molecular formula C27H22N2O2S3 and a molecular weight of 502.69 g/mol. Its IUPAC name is 5-[(4-methylphenyl)methylidene]-3-(4-oxo-4-phenothiazin-10-ylbutyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[(4-methylphenyl)methylidene]-3-(4-oxo-4-phenothiazin-10-ylbutyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5221372 |
| Molecular Formula | C27H22N2O2S3 |
| Molecular Weight | 502.69 g/mol |
| Exact Mass | 502.08 |
| IUPAC Name | 5-[(4-methylphenyl)methylidene]-3-(4-oxo-4-phenothiazin-10-ylbutyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(C=C2SC(=S)N(CCCC(=O)N3c4ccccc4Sc4ccccc43)C2=O)cc1 |
| InChI | InChI=1S/C27H22N2O2S3/c1-18-12-14-19(15-13-18)17-24-26(31)28(27(32)34-24)16-6-11-25(30)29-20-7-2-4-9-22(20)33-23-10-5-3-8-21(23)29/h2-5,7-10,12-15,17H,6,11,16H2,1H3 |
| InChIKey | NLCHEDZWHVHOPW-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.69 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|