C27H21ClN2O2S3 — CID 3571178
3-[4-(2-chlorophenothiazin-10-yl)-4-oxobutyl]-5-[(4-methylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3571178) has the molecular formula C27H21ClN2O2S3 and a molecular weight of 537.13 g/mol. Its IUPAC name is 3-[4-(2-chlorophenothiazin-10-yl)-4-oxobutyl]-5-[(4-methylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-[4-(2-chlorophenothiazin-10-yl)-4-oxobutyl]-5-[(4-methylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3571178 |
| Molecular Formula | C27H21ClN2O2S3 |
| Molecular Weight | 537.13 g/mol |
| Exact Mass | 536.05 |
| IUPAC Name | 3-[4-(2-chlorophenothiazin-10-yl)-4-oxobutyl]-5-[(4-methylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(C=C2SC(=S)N(CCCC(=O)N3c4ccccc4Sc4ccc(Cl)cc43)C2=O)cc1 |
| InChI | InChI=1S/C27H21ClN2O2S3/c1-17-8-10-18(11-9-17)15-24-26(32)29(27(33)35-24)14-4-7-25(31)30-20-5-2-3-6-22(20)34-23-13-12-19(28)16-21(23)30/h2-3,5-6,8-13,15-16H,4,7,14H2,1H3 |
| InChIKey | PRVYZDZPLMNMKE-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.13 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|